C17H17F2NO5S2 — CID 55340437
N-[2-(difluoromethylsulfonyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 55340437) has the molecular formula C17H17F2NO5S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 55340437 |
| Molecular Formula | C17H17F2NO5S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Nc2ccccc2S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H17F2NO5S2/c1-12-6-8-13(9-7-12)26(22,23)11-10-16(21)20-14-4-2-3-5-15(14)27(24,25)17(18)19/h2-9,17H,10-11H2,1H3,(H,20,21) |
| InChIKey | FTFNIOMHNWDJKH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |