C24H26N6O5 — CID 55341355
N'-(5-nitro-2-piperidin-1-ylbenzoyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide (PubChem CID 55341355) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is N'-(5-nitro-2-piperidin-1-ylbenzoyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide.
| Compound Name | N'-(5-nitro-2-piperidin-1-ylbenzoyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55341355 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N'-(5-nitro-2-piperidin-1-ylbenzoyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide |
| SMILES | CC(C)n1nc(C(=O)NNC(=O)c2cc([N+](=O)[O-])ccc2N2CCCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H26N6O5/c1-15(2)29-24(33)18-9-5-4-8-17(18)21(27-29)23(32)26-25-22(31)19-14-16(30(34)35)10-11-20(19)28-12-6-3-7-13-28/h4-5,8-11,14-15H,3,6-7,12-13H2,1-2H3,(H,25,31)(H,26,32) |
| InChIKey | KXOWKVXPMXLOIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|