C22H23ClN4O5S — CID 55343028
N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide (PubChem CID 55343028) has the molecular formula C22H23ClN4O5S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide.
| Compound Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55343028 |
| Molecular Formula | C22H23ClN4O5S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
| SMILES | CC(C)n1nc(C(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H23ClN4O5S/c1-14(2)27-22(29)17-6-4-3-5-16(17)20(25-27)21(28)24-15-7-8-18(23)19(13-15)33(30,31)26-9-11-32-12-10-26/h3-8,13-14H,9-12H2,1-2H3,(H,24,28) |
| InChIKey | KHWPQSJOWZSBEG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |