C15H15ClN2O5S — CID 27007356
N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)furan-3-carboxamide (PubChem CID 27007356) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)furan-3-carboxamide.
| Compound Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 27007356 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)furan-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)c1ccoc1 |
| InChI | InChI=1S/C15H15ClN2O5S/c16-13-2-1-12(17-15(19)11-3-6-23-10-11)9-14(13)24(20,21)18-4-7-22-8-5-18/h1-3,6,9-10H,4-5,7-8H2,(H,17,19) |
| InChIKey | ZOKWICANOIFSET-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |