C25H20ClN3O6S — CID 4262574
N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 4262574) has the molecular formula C25H20ClN3O6S and a molecular weight of 525.97 g/mol. Its IUPAC name is N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 4262574 |
| Molecular Formula | C25H20ClN3O6S |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C25H20ClN3O6S/c26-21-9-8-17(15-22(21)36(33,34)28-10-12-35-13-11-28)27-23(30)16-4-3-5-18(14-16)29-24(31)19-6-1-2-7-20(19)25(29)32/h1-9,14-15H,10-13H2,(H,27,30) |
| InChIKey | KQSLGZQZTVFXQK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|