C27H37N3O5 — CID 55343904
1-(adamantane-1-carbonyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]pyrrolidine-2-carbohydrazide (PubChem CID 55343904) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]pyrrolidine-2-carbohydrazide.
| Compound Name | 1-(adamantane-1-carbonyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 55343904 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]pyrrolidine-2-carbohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)C2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H37N3O5/c1-3-34-21-6-8-22(9-7-21)35-17(2)24(31)28-29-25(32)23-5-4-10-30(23)26(33)27-14-18-11-19(15-27)13-20(12-18)16-27/h6-9,17-20,23H,3-5,10-16H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | NUKAHQVIAUOPGA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|