C22H25N3O5 — CID 55344146
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]acetamide (PubChem CID 55344146) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 55344146 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)C(=O)CN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C22H25N3O5/c1-3-24(11-17(26)23-15-5-4-6-16(10-15)30-2)18(27)12-25-21(28)19-13-7-8-14(9-13)20(19)22(25)29/h4-8,10,13-14,19-20H,3,9,11-12H2,1-2H3,(H,23,26) |
| InChIKey | BDPILPVFKZSNEX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|