C21H26N2O6 — CID 55344386
N-ethyl-2,3,4-trimethoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]benzamide (PubChem CID 55344386) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-ethyl-2,3,4-trimethoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]benzamide.
| Compound Name | N-ethyl-2,3,4-trimethoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55344386 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-ethyl-2,3,4-trimethoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)C(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C21H26N2O6/c1-6-23(13-18(24)22-14-8-7-9-15(12-14)26-2)21(25)16-10-11-17(27-3)20(29-5)19(16)28-4/h7-12H,6,13H2,1-5H3,(H,22,24) |
| InChIKey | MMVKWMIILVUTSQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |