C21H25N3O7 — CID 34778054
4-ethoxy-N-ethyl-5-methoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-nitrobenzamide (PubChem CID 34778054) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-5-methoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-nitrobenzamide.
| Compound Name | 4-ethoxy-N-ethyl-5-methoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 34778054 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-ethoxy-N-ethyl-5-methoxy-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-nitrobenzamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)N(CC)CC(=O)Nc2cccc(OC)c2)cc1OC |
| InChI | InChI=1S/C21H25N3O7/c1-5-23(13-20(25)22-14-8-7-9-15(10-14)29-3)21(26)16-11-18(30-4)19(31-6-2)12-17(16)24(27)28/h7-12H,5-6,13H2,1-4H3,(H,22,25) |
| InChIKey | YUADEGKZCYTBJO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|