C24H26N2O4 — CID 55347711
methyl 4-[[2-(2,3-dihydroindole-1-carbonyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 55347711) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 4-[[2-(2,3-dihydroindole-1-carbonyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2,3-dihydroindole-1-carbonyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 55347711 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl 4-[[2-(2,3-dihydroindole-1-carbonyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCCCC2C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-30-24(29)17-10-12-18(13-11-17)25-22(27)19-7-3-4-8-20(19)23(28)26-15-14-16-6-2-5-9-21(16)26/h2,5-6,9-13,19-20H,3-4,7-8,14-15H2,1H3,(H,25,27) |
| InChIKey | LZGIAAJHJGBMLG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |