C27H33N3O4 — CID 55305730
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate (PubChem CID 55305730) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55305730 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate |
| SMILES | CC(OC(=O)C1CCCCC1C(=O)N1CCc2ccccc21)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H33N3O4/c1-18(25(31)28-20-12-14-21(15-13-20)29(2)3)34-27(33)23-10-6-5-9-22(23)26(32)30-17-16-19-8-4-7-11-24(19)30/h4,7-8,11-15,18,22-23H,5-6,9-10,16-17H2,1-3H3,(H,28,31) |
| InChIKey | SMUVTYDEEBEYOE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|