C19H19ClFN3O6S — CID 55348490
4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-fluoro-5-nitrophenyl)benzamide (PubChem CID 55348490) has the molecular formula C19H19ClFN3O6S and a molecular weight of 471.89 g/mol. Its IUPAC name is 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-fluoro-5-nitrophenyl)benzamide.
| Compound Name | 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-fluoro-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 55348490 |
| Molecular Formula | C19H19ClFN3O6S |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-fluoro-5-nitrophenyl)benzamide |
| SMILES | CC1CN(S(=O)(=O)c2cc(C(=O)Nc3cc([N+](=O)[O-])ccc3F)ccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C19H19ClFN3O6S/c1-11-9-23(10-12(2)30-11)31(28,29)18-7-13(3-5-15(18)20)19(25)22-17-8-14(24(26)27)4-6-16(17)21/h3-8,11-12H,9-10H2,1-2H3,(H,22,25) |
| InChIKey | HAJWMPMEBRHWFQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|