C22H26Cl2N4O3 — CID 55351462
N-(2,3-dichlorophenyl)-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide (PubChem CID 55351462) has the molecular formula C22H26Cl2N4O3 and a molecular weight of 465.38 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 55351462 |
| Molecular Formula | C22H26Cl2N4O3 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide |
| SMILES | CC(C(=O)Nc1cccc(Cl)c1Cl)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26Cl2N4O3/c1-15(22(30)26-19-5-3-4-18(23)21(19)24)27(2)14-20(29)25-16-6-8-17(9-7-16)28-10-12-31-13-11-28/h3-9,15H,10-14H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | DYPUMRVGQFSBNJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|