C22H36N4O3 — CID 55430711
2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N,N-di(propan-2-yl)propanamide (PubChem CID 55430711) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N,N-di(propan-2-yl)propanamide.
| Compound Name | 2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 55430711 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C(=O)N(C(C)C)C(C)C)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H36N4O3/c1-16(2)26(17(3)4)22(28)18(5)24(6)15-21(27)23-19-7-9-20(10-8-19)25-11-13-29-14-12-25/h7-10,16-18H,11-15H2,1-6H3,(H,23,27) |
| InChIKey | YSLZTMKVBPSNIE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|