C21H18Cl2N4O3 — CID 55353079
N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 55353079) has the molecular formula C21H18Cl2N4O3 and a molecular weight of 445.31 g/mol. Its IUPAC name is N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 55353079 |
| Molecular Formula | C21H18Cl2N4O3 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2)c(Cl)c1/C=N/NC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C21H18Cl2N4O3/c1-13-16(20(23)27(26-13)11-14-6-8-15(22)9-7-14)10-24-25-21(28)19-12-29-17-4-2-3-5-18(17)30-19/h2-10,19H,11-12H2,1H3,(H,25,28)/b24-10+ |
| InChIKey | HTMRVNJDCXDTSZ-YSURURNPSA-N |
| XLogP | 3.84 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|