C26H26FN3O4 — CID 55356177
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate (PubChem CID 55356177) has the molecular formula C26H26FN3O4 and a molecular weight of 463.51 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 55356177 |
| Molecular Formula | C26H26FN3O4 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)/C=C/c2c(C)nn(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C26H26FN3O4/c1-4-5-25(32)28-21-10-6-19(7-11-21)24(31)16-34-26(33)15-14-23-17(2)29-30(18(23)3)22-12-8-20(27)9-13-22/h6-15H,4-5,16H2,1-3H3,(H,28,32)/b15-14+ |
| InChIKey | XJTVAAJNUBYMKZ-CCEZHUSRSA-N |
| XLogP | 4.81 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|