C17H12BrN3O5 — CID 55356270
(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-bromo-3-nitrobenzoate (PubChem CID 55356270) has the molecular formula C17H12BrN3O5 and a molecular weight of 418.20 g/mol. Its IUPAC name is (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-bromo-3-nitrobenzoate.
| Compound Name | (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 55356270 |
| Molecular Formula | C17H12BrN3O5 |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-bromo-3-nitrobenzoate |
| SMILES | Cc1cccc2nc(COC(=O)c3ccc(Br)c([N+](=O)[O-])c3)cc(=O)n12 |
| InChI | InChI=1S/C17H12BrN3O5/c1-10-3-2-4-15-19-12(8-16(22)20(10)15)9-26-17(23)11-5-6-13(18)14(7-11)21(24)25/h2-8H,9H2,1H3 |
| InChIKey | WBVWAWKQZJDBGA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|