C17H14N2O3 — CID 55356992
5-(3,4-dimethylphenoxy)-8-nitroisoquinoline (PubChem CID 55356992) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-(3,4-dimethylphenoxy)-8-nitroisoquinoline.
| Compound Name | 5-(3,4-dimethylphenoxy)-8-nitroisoquinoline |
|---|---|
| PubChem CID | 55356992 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-(3,4-dimethylphenoxy)-8-nitroisoquinoline |
| SMILES | Cc1ccc(Oc2ccc([N+](=O)[O-])c3cnccc23)cc1C |
| InChI | InChI=1S/C17H14N2O3/c1-11-3-4-13(9-12(11)2)22-17-6-5-16(19(20)21)15-10-18-8-7-14(15)17/h3-10H,1-2H3 |
| InChIKey | KLHYSHZYGNJNRM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|