C24H26N2O7 — CID 55357288
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate (PubChem CID 55357288) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55357288 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)CCC(=O)c2ccc3c(c2)CCC3)cc1OC |
| InChI | InChI=1S/C24H26N2O7/c1-31-20-10-8-18(13-21(20)32-2)24(30)26-25-22(28)14-33-23(29)11-9-19(27)17-7-6-15-4-3-5-16(15)12-17/h6-8,10,12-13H,3-5,9,11,14H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | FQBORLHBSBUIJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|