C24H23F2NO3 — CID 55359274
2-benzhydryloxy-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide (PubChem CID 55359274) has the molecular formula C24H23F2NO3 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-benzhydryloxy-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-benzhydryloxy-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55359274 |
| Molecular Formula | C24H23F2NO3 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-benzhydryloxy-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)COC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23F2NO3/c1-27(16-18-12-14-21(15-13-18)30-24(25)26)22(28)17-29-23(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,23-24H,16-17H2,1H3 |
| InChIKey | FTEGSUNUCNXMDS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |