C21H33N3O4S — CID 55359689
N-butyl-1-[4-(diethylsulfamoyl)phenyl]-N-ethyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 55359689) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-butyl-1-[4-(diethylsulfamoyl)phenyl]-N-ethyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-butyl-1-[4-(diethylsulfamoyl)phenyl]-N-ethyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55359689 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-butyl-1-[4-(diethylsulfamoyl)phenyl]-N-ethyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN(CC)C(=O)C1CC(=O)N(c2ccc(S(=O)(=O)N(CC)CC)cc2)C1 |
| InChI | InChI=1S/C21H33N3O4S/c1-5-9-14-22(6-2)21(26)17-15-20(25)24(16-17)18-10-12-19(13-11-18)29(27,28)23(7-3)8-4/h10-13,17H,5-9,14-16H2,1-4H3 |
| InChIKey | RXMVCQGMWCRCRR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |