C23H23N5O3 — CID 55359743
N-(2-benzylpyrazol-3-yl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55359743) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(2-benzylpyrazol-3-yl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-benzylpyrazol-3-yl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55359743 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(2-benzylpyrazol-3-yl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccnn3Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-16-8-10-18(11-9-16)23(2)21(30)27(22(31)26-23)15-20(29)25-19-12-13-24-28(19)14-17-6-4-3-5-7-17/h3-13H,14-15H2,1-2H3,(H,25,29)(H,26,31) |
| InChIKey | BGOQUHQUEBNYQY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|