C24H29N3O3S — CID 55360894
N-[[4-(dimethylamino)phenyl]methyl]-4-oxo-N-(oxolan-2-ylmethyl)-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide (PubChem CID 55360894) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-4-oxo-N-(oxolan-2-ylmethyl)-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-4-oxo-N-(oxolan-2-ylmethyl)-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 55360894 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-4-oxo-N-(oxolan-2-ylmethyl)-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
| SMILES | CN(C)c1ccc(CN(CC2CCCO2)C(=O)c2ccc3c(c2)NC(=O)CCS3)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-26(2)19-8-5-17(6-9-19)15-27(16-20-4-3-12-30-20)24(29)18-7-10-22-21(14-18)25-23(28)11-13-31-22/h5-10,14,20H,3-4,11-13,15-16H2,1-2H3,(H,25,28) |
| InChIKey | ISAJNZWPYPREHH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|