C23H19N3O3S — CID 55361626
N-(1,3-benzodioxol-5-yl)-2-[3-(1,3-benzothiazol-2-yl)anilino]propanamide (PubChem CID 55361626) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-(1,3-benzothiazol-2-yl)anilino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-(1,3-benzothiazol-2-yl)anilino]propanamide |
|---|---|
| PubChem CID | 55361626 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-(1,3-benzothiazol-2-yl)anilino]propanamide |
| SMILES | CC(Nc1cccc(-c2nc3ccccc3s2)c1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19N3O3S/c1-14(22(27)25-17-9-10-19-20(12-17)29-13-28-19)24-16-6-4-5-15(11-16)23-26-18-7-2-3-8-21(18)30-23/h2-12,14,24H,13H2,1H3,(H,25,27) |
| InChIKey | OBGSJABCVKZFAB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |