C16H14BrNO4S — CID 55368314
[2-(2-bromoanilino)-2-oxoethyl] 4-methylsulfinylbenzoate (PubChem CID 55368314) has the molecular formula C16H14BrNO4S and a molecular weight of 396.26 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl] 4-methylsulfinylbenzoate.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl] 4-methylsulfinylbenzoate |
|---|---|
| PubChem CID | 55368314 |
| Molecular Formula | C16H14BrNO4S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl] 4-methylsulfinylbenzoate |
| SMILES | CS(=O)c1ccc(C(=O)OCC(=O)Nc2ccccc2Br)cc1 |
| InChI | InChI=1S/C16H14BrNO4S/c1-23(21)12-8-6-11(7-9-12)16(20)22-10-15(19)18-14-5-3-2-4-13(14)17/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | OIMQSELIABJPAY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |