About [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate
[2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate (PubChem CID 55490603) has the molecular formula C17H17NO4S2
and a molecular weight of 363.46 g/mol. Its IUPAC name is [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate.
Molecular Properties
| Compound Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate |
| PubChem CID | 55490603 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate |
| SMILES | CSc1ccc(NC(=O)COC(=O)c2ccc(S(C)=O)cc2)cc1 |
| InChI | InChI=1S/C17H17NO4S2/c1-23-14-7-5-13(6-8-14)18-16(19)11-22-17(20)12-3-9-15(10-4-12)24(2)21/h3-10H,11H2,1-2H3,(H,18,19) |
| InChIKey | VPKCWKVYPNQBHF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate?
The IUPAC name of [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate (CID 55490603) is [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate.
What is the SMILES notation for [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate?
The canonical SMILES for [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate is CSc1ccc(NC(=O)COC(=O)c2ccc(S(C)=O)cc2)cc1.
What is the InChIKey of [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate?
The InChIKey is VPKCWKVYPNQBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4S2/c1-23-14-7-5-13(6-8-14)18-16(19)11-22-17(20)12-3-9-15(10-4-12)24(2)21/h3-10H,11H2,1-2H3,(H,18,19).
What are the key properties of [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate?
[2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate has a molecular weight of 363.46 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylsulfanylanilino)-2-oxoethyl] 4-methylsulfinylbenzoate is sourced from PubChem (CID 55490603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).