C25H31N5O5 — CID 55369612
N-(2,6-dimethylphenyl)-2-[4-(2-morpholin-4-yl-5-nitrobenzoyl)piperazin-1-yl]acetamide (PubChem CID 55369612) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(2-morpholin-4-yl-5-nitrobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(2-morpholin-4-yl-5-nitrobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55369612 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(2-morpholin-4-yl-5-nitrobenzoyl)piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN(C(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C25H31N5O5/c1-18-4-3-5-19(2)24(18)26-23(31)17-27-8-10-29(11-9-27)25(32)21-16-20(30(33)34)6-7-22(21)28-12-14-35-15-13-28/h3-7,16H,8-15,17H2,1-2H3,(H,26,31) |
| InChIKey | VWCFZLMDFMCBBM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|