C21H23N3O5S — CID 55370659
[2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55370659) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is [2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55370659 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | CN(C(=O)COC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C21H23N3O5S/c1-23(18-8-4-6-15-5-2-3-7-17(15)18)20(25)14-29-21(26)16-9-10-19-22-30(27,28)12-11-24(19)13-16/h2-3,5,7,9-10,13,18H,4,6,8,11-12,14H2,1H3 |
| InChIKey | OFGFLSLCGSEHLY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |