C19H25N3O7S2 — CID 55393121
[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55393121) has the molecular formula C19H25N3O7S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is [2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55393121 |
| Molecular Formula | C19H25N3O7S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(OCC(=O)N(C1CCCC1)C1CCS(=O)(=O)C1)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C19H25N3O7S2/c23-18(22(15-3-1-2-4-15)16-7-9-30(25,26)13-16)12-29-19(24)14-5-6-17-20-31(27,28)10-8-21(17)11-14/h5-6,11,15-16H,1-4,7-10,12-13H2 |
| InChIKey | UZLXXGZNZZMLSB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 130.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |