C24H21N5O5S — CID 55371026
N-(1,3-benzothiazol-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxo-N-(oxolan-2-ylmethyl)pyridazine-3-carboxamide (PubChem CID 55371026) has the molecular formula C24H21N5O5S and a molecular weight of 491.53 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxo-N-(oxolan-2-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxo-N-(oxolan-2-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55371026 |
| Molecular Formula | C24H21N5O5S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxo-N-(oxolan-2-ylmethyl)pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)N(CC2CCCO2)c2nc3ccccc3s2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N5O5S/c1-15-13-20(30)22(26-28(15)18-9-3-4-10-19(18)29(32)33)23(31)27(14-16-7-6-12-34-16)24-25-17-8-2-5-11-21(17)35-24/h2-5,8-11,13,16H,6-7,12,14H2,1H3 |
| InChIKey | CYVVISIVDPHCJH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|