C19H23N3O2S2 — CID 55373822
N-(cyclohexen-1-yl)-N-ethyl-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 55373822) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is N-(cyclohexen-1-yl)-N-ethyl-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(cyclohexen-1-yl)-N-ethyl-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55373822 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(cyclohexen-1-yl)-N-ethyl-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(CC)C2=CCCCC2)nc2sccc2c1=O |
| InChI | InChI=1S/C19H23N3O2S2/c1-3-11-22-18(24)15-10-12-25-17(15)20-19(22)26-13-16(23)21(4-2)14-8-6-5-7-9-14/h3,8,10,12H,1,4-7,9,11,13H2,2H3 |
| InChIKey | SMAKFIXRTNKBOI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|