C23H20N2O5 — CID 55375241
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55375241) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55375241 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(C(C)C(=O)OCC(=O)c1c(C)[nH]c3ccccc13)C2=O |
| InChI | InChI=1S/C23H20N2O5/c1-12-8-9-15-17(10-12)22(28)25(21(15)27)14(3)23(29)30-11-19(26)20-13(2)24-18-7-5-4-6-16(18)20/h4-10,14,24H,11H2,1-3H3 |
| InChIKey | NENKJHUVEIMARJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|