C24H27N3O4S2 — CID 55375351
[2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 55375351) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is [2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | [2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 55375351 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | [2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | CC(=O)N(c1nc(COC(=O)CCCNC(=O)c2ccsc2)cs1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H27N3O4S2/c1-15-10-16(2)22(17(3)11-15)27(18(4)28)24-26-20(14-33-24)12-31-21(29)6-5-8-25-23(30)19-7-9-32-13-19/h7,9-11,13-14H,5-6,8,12H2,1-4H3,(H,25,30) |
| InChIKey | RLKABDYPEZADGJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|