C25H28N2O5S — CID 55306608
[2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-(4-methoxyphenoxy)butanoate (PubChem CID 55306608) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is [2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 55306608 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)OCc2csc(N(C(C)=O)c3ccc(C)c(C)c3)n2)cc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-17-7-8-21(14-18(17)2)27(19(3)28)25-26-20(16-33-25)15-32-24(29)6-5-13-31-23-11-9-22(30-4)10-12-23/h7-12,14,16H,5-6,13,15H2,1-4H3 |
| InChIKey | YWXRZUUDWZRHHS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|