C24H20ClN3O3S — CID 55998379
[2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-chloroquinoline-6-carboxylate (PubChem CID 55998379) has the molecular formula C24H20ClN3O3S and a molecular weight of 465.96 g/mol. Its IUPAC name is [2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55998379 |
| Molecular Formula | C24H20ClN3O3S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | [2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-chloroquinoline-6-carboxylate |
| SMILES | CC(=O)N(c1ccc(C)c(C)c1)c1nc(COC(=O)c2ccc3nc(Cl)ccc3c2)cs1 |
| InChI | InChI=1S/C24H20ClN3O3S/c1-14-4-7-20(10-15(14)2)28(16(3)29)24-26-19(13-32-24)12-31-23(30)18-5-8-21-17(11-18)6-9-22(25)27-21/h4-11,13H,12H2,1-3H3 |
| InChIKey | NQPPPKWZCQXQNR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|