C22H22ClN3O4 — CID 55377766
(E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 55377766) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is (E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55377766 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(C)nn2-c2cccc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22ClN3O4/c1-14-10-20(26(25-14)17-7-5-6-16(23)13-17)24-21(27)9-8-15-11-18(28-2)22(30-4)19(12-15)29-3/h5-13H,1-4H3,(H,24,27)/b9-8+ |
| InChIKey | IPNAINFGXWYPDP-CMDGGOBGSA-N |
| XLogP | 4.51 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|