C22H19ClN4O3 — CID 55480637
(E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 55480637) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is (E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55480637 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (E)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(C)nn2-c2cccc(Cl)c2)ccc1OCC#N |
| InChI | InChI=1S/C22H19ClN4O3/c1-15-12-21(27(26-15)18-5-3-4-17(23)14-18)25-22(28)9-7-16-6-8-19(30-11-10-24)20(13-16)29-2/h3-9,12-14H,11H2,1-2H3,(H,25,28)/b9-7+ |
| InChIKey | DSAKIDCFOCFGMD-VQHVLOKHSA-N |
| XLogP | 4.40 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|