C19H16ClN3O4 — CID 4806020
3-chloro-N'-[3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]benzohydrazide (PubChem CID 4806020) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is 3-chloro-N'-[3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 4806020 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-chloro-N'-[3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]benzohydrazide |
| SMILES | COc1cc(C=CC(=O)NNC(=O)c2cccc(Cl)c2)ccc1OCC#N |
| InChI | InChI=1S/C19H16ClN3O4/c1-26-17-11-13(5-7-16(17)27-10-9-21)6-8-18(24)22-23-19(25)14-3-2-4-15(20)12-14/h2-8,11-12H,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | HSQIUNPKJPWFEJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|