C19H15N5O3S2 — CID 55378726
2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 55378726) has the molecular formula C19H15N5O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 55378726 |
| Molecular Formula | C19H15N5O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CSc3nnc(Nc4ccccc4)s3)cc2C1=O |
| InChI | InChI=1S/C19H15N5O3S2/c1-24-16(26)13-8-7-12(9-14(13)17(24)27)20-15(25)10-28-19-23-22-18(29-19)21-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,20,25)(H,21,22) |
| InChIKey | XGCSZKCUMYMHJF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|