C25H32N4O5 — CID 55379448
3-acetamido-3-(4-methoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide (PubChem CID 55379448) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-acetamido-3-(4-methoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide.
| Compound Name | 3-acetamido-3-(4-methoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 55379448 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-acetamido-3-(4-methoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide |
| SMILES | COc1ccc(C(CC(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)NC(C)=O)cc1 |
| InChI | InChI=1S/C25H32N4O5/c1-18(30)26-23(19-4-10-22(33-3)11-5-19)16-25(32)28(2)17-24(31)27-20-6-8-21(9-7-20)29-12-14-34-15-13-29/h4-11,23H,12-17H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | WFDYHFYFWZFUBQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|