C24H29N3O5 — CID 55413486
(E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]prop-2-enamide (PubChem CID 55413486) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55413486 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-26(24(29)9-4-18-14-21(30-2)16-22(15-18)31-3)17-23(28)25-19-5-7-20(8-6-19)27-10-12-32-13-11-27/h4-9,14-16H,10-13,17H2,1-3H3,(H,25,28)/b9-4+ |
| InChIKey | ZTOZSLOHSPTJJX-RUDMXATFSA-N |
| XLogP | 2.65 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|