C25H26N2O4 — CID 55380656
2-[3-(2-ethoxyphenyl)propanoylamino]-N-(3-methoxyphenyl)benzamide (PubChem CID 55380656) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[3-(2-ethoxyphenyl)propanoylamino]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 2-[3-(2-ethoxyphenyl)propanoylamino]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 55380656 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[3-(2-ethoxyphenyl)propanoylamino]-N-(3-methoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1CCC(=O)Nc1ccccc1C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-3-31-23-14-7-4-9-18(23)15-16-24(28)27-22-13-6-5-12-21(22)25(29)26-19-10-8-11-20(17-19)30-2/h4-14,17H,3,15-16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | PJKZCAJFGNCLBF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |