C20H21N3O3 — CID 55380893
N-[1-(1H-benzimidazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 55380893) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55380893 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(C)c2nc3ccccc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-13(20-22-16-6-4-5-7-17(16)23-20)21-19(24)11-9-14-8-10-15(25-2)12-18(14)26-3/h4-13H,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | UCIIQJOEEHXEBF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|