C21H24N4O5S — CID 55381026
4-methoxy-N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 55381026) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-methoxy-N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-methoxy-N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55381026 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-methoxy-N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(NC(=O)c2nn(-c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-15(14-29-2)24-31(27,28)18-11-9-16(10-12-18)22-21(26)20-19(30-3)13-25(23-20)17-7-5-4-6-8-17/h4-13,15,24H,14H2,1-3H3,(H,22,26) |
| InChIKey | CFTYNMSSPZIXMD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |