C22H28ClN3O5S — CID 55382016
N-(5-chloro-2-methoxyphenyl)-2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)propanamide (PubChem CID 55382016) has the molecular formula C22H28ClN3O5S and a molecular weight of 482.00 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)propanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 55382016 |
| Molecular Formula | C22H28ClN3O5S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)propanamide |
| SMILES | CCOc1ccc(NC(C)C(=O)Nc2cc(Cl)ccc2OC)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C22H28ClN3O5S/c1-4-31-20-10-8-17(14-21(20)32(28,29)26-11-5-6-12-26)24-15(2)22(27)25-18-13-16(23)7-9-19(18)30-3/h7-10,13-15,24H,4-6,11-12H2,1-3H3,(H,25,27) |
| InChIKey | DSNAZFFVLSQYKE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|