C18H17F3N4O5S2 — CID 55383998
(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55383998) has the molecular formula C18H17F3N4O5S2 and a molecular weight of 490.49 g/mol. Its IUPAC name is (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55383998 |
| Molecular Formula | C18H17F3N4O5S2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1=CC=CN2CCS(=O)(=O)N=C12)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H17F3N4O5S2/c19-13-3-4-14(16(21)15(13)20)32(29,30)25-8-6-24(7-9-25)18(26)12-2-1-5-23-10-11-31(27,28)22-17(12)23/h1-5H,6-11H2 |
| InChIKey | UNKGQIMOMPOOKB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 107.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|