C24H26ClN3O5 — CID 55387478
N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine (PubChem CID 55387478) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine.
| Compound Name | N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 55387478 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine |
| SMILES | COc1ccc(C(CNCc2ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H26ClN3O5/c1-31-19-5-2-17(3-6-19)23(27-10-12-32-13-11-27)16-26-15-20-7-9-24(33-20)21-8-4-18(25)14-22(21)28(29)30/h2-9,14,23,26H,10-13,15-16H2,1H3 |
| InChIKey | JAEKPZRAGQZZJH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|