C25H33N3O4 — CID 55387522
N-[bis(4-methoxyphenyl)methyl]-2-[4-(2-methylpropanoyl)piperazin-1-yl]acetamide (PubChem CID 55387522) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[bis(4-methoxyphenyl)methyl]-2-[4-(2-methylpropanoyl)piperazin-1-yl]acetamide.
| Compound Name | N-[bis(4-methoxyphenyl)methyl]-2-[4-(2-methylpropanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55387522 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-[bis(4-methoxyphenyl)methyl]-2-[4-(2-methylpropanoyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(C(NC(=O)CN2CCN(C(=O)C(C)C)CC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-18(2)25(30)28-15-13-27(14-16-28)17-23(29)26-24(19-5-9-21(31-3)10-6-19)20-7-11-22(32-4)12-8-20/h5-12,18,24H,13-17H2,1-4H3,(H,26,29) |
| InChIKey | GCPBBFKVXZAVKU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |