C28H39N3O3 — CID 55986995
N-[bis(4-methoxyphenyl)methyl]-2-[4-(cyclohexylmethyl)piperazin-1-yl]acetamide (PubChem CID 55986995) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[bis(4-methoxyphenyl)methyl]-2-[4-(cyclohexylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[bis(4-methoxyphenyl)methyl]-2-[4-(cyclohexylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55986995 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-[bis(4-methoxyphenyl)methyl]-2-[4-(cyclohexylmethyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(C(NC(=O)CN2CCN(CC3CCCCC3)CC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H39N3O3/c1-33-25-12-8-23(9-13-25)28(24-10-14-26(34-2)15-11-24)29-27(32)21-31-18-16-30(17-19-31)20-22-6-4-3-5-7-22/h8-15,22,28H,3-7,16-21H2,1-2H3,(H,29,32) |
| InChIKey | SZQVZFNABOTOFL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |