C21H16N2O3S — CID 55388121
(7-methoxynaphthalen-2-yl) 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate (PubChem CID 55388121) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | (7-methoxynaphthalen-2-yl) 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 55388121 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
| SMILES | COc1ccc2ccc(OC(=O)Cc3csc(-c4cccnc4)n3)cc2c1 |
| InChI | InChI=1S/C21H16N2O3S/c1-25-18-6-4-14-5-7-19(10-16(14)9-18)26-20(24)11-17-13-27-21(23-17)15-3-2-8-22-12-15/h2-10,12-13H,11H2,1H3 |
| InChIKey | OKGUVFKZSLSDRC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|